C18H25FN4O2 — CID 90133993
ethyl 7-[(5-fluoro-2-pyridinyl)-(1-methylpyrazol-3-yl)amino]heptanoate (PubChem CID 90133993) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is ethyl 7-[(5-fluoro-2-pyridinyl)-(1-methylpyrazol-3-yl)amino]heptanoate.
| Compound Name | ethyl 7-[(5-fluoro-2-pyridinyl)-(1-methylpyrazol-3-yl)amino]heptanoate |
|---|---|
| PubChem CID | 90133993 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | ethyl 7-[(5-fluoro-2-pyridinyl)-(1-methylpyrazol-3-yl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(c1ccc(F)cn1)c1ccn(C)n1 |
| InChI | InChI=1S/C18H25FN4O2/c1-3-25-18(24)8-6-4-5-7-12-23(17-11-13-22(2)21-17)16-10-9-15(19)14-20-16/h9-11,13-14H,3-8,12H2,1-2H3 |
| InChIKey | JJJGKMNUTBGFCF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|