C26H31N3O3 — CID 90348242
ethyl 7-[(6-phenylmethoxy-3-pyridinyl)-pyridin-2-ylamino]heptanoate (PubChem CID 90348242) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 7-[(6-phenylmethoxy-3-pyridinyl)-pyridin-2-ylamino]heptanoate.
| Compound Name | ethyl 7-[(6-phenylmethoxy-3-pyridinyl)-pyridin-2-ylamino]heptanoate |
|---|---|
| PubChem CID | 90348242 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | ethyl 7-[(6-phenylmethoxy-3-pyridinyl)-pyridin-2-ylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(c1ccc(OCc2ccccc2)nc1)c1ccccn1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-31-26(30)15-8-3-4-11-19-29(24-14-9-10-18-27-24)23-16-17-25(28-20-23)32-21-22-12-6-5-7-13-22/h5-7,9-10,12-14,16-18,20H,2-4,8,11,15,19,21H2,1H3 |
| InChIKey | OSXJDRGENYGQOG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|