C17H22N4O2 — CID 174703078
5-[3-amino-4-(methylamino)-N-pyridin-2-ylanilino]pentanoic acid (PubChem CID 174703078) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-[3-amino-4-(methylamino)-N-pyridin-2-ylanilino]pentanoic acid.
| Compound Name | 5-[3-amino-4-(methylamino)-N-pyridin-2-ylanilino]pentanoic acid |
|---|---|
| PubChem CID | 174703078 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-[3-amino-4-(methylamino)-N-pyridin-2-ylanilino]pentanoic acid |
| SMILES | CNc1ccc(N(CCCCC(=O)O)c2ccccn2)cc1N |
| InChI | InChI=1S/C17H22N4O2/c1-19-15-9-8-13(12-14(15)18)21(11-5-3-7-17(22)23)16-6-2-4-10-20-16/h2,4,6,8-10,12,19H,3,5,7,11,18H2,1H3,(H,22,23) |
| InChIKey | ZMJKXMLEQYSHPH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|