C18H20N4O4 — CID 88954755
ethyl 3-[[4-(methylamino)-3-nitrosobenzoyl]-pyridin-2-ylamino]propanoate (PubChem CID 88954755) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 3-[[4-(methylamino)-3-nitrosobenzoyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[4-(methylamino)-3-nitrosobenzoyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 88954755 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 3-[[4-(methylamino)-3-nitrosobenzoyl]-pyridin-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc(NC)c(N=O)c1)c1ccccn1 |
| InChI | InChI=1S/C18H20N4O4/c1-3-26-17(23)9-11-22(16-6-4-5-10-20-16)18(24)13-7-8-14(19-2)15(12-13)21-25/h4-8,10,12,19H,3,9,11H2,1-2H3 |
| InChIKey | MQVVXJYVECZWBR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |