C18H19ClN4O3 — CID 71258111
ethyl 3-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]propanoate;hydrochloride (PubChem CID 71258111) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is ethyl 3-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 71258111 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | ethyl 3-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2nc[nH]c2c1)c1ccccn1.Cl |
| InChI | InChI=1S/C18H18N4O3.ClH/c1-2-25-17(23)8-10-22(16-5-3-4-9-19-16)18(24)13-6-7-14-15(11-13)21-12-20-14;/h3-7,9,11-12H,2,8,10H2,1H3,(H,20,21);1H |
| InChIKey | RKSYCTYQOWUFTD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |