C17H18Cl2N4O3 — CID 141002162
ethyl 2-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]acetate;dihydrochloride (PubChem CID 141002162) has the molecular formula C17H18Cl2N4O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is ethyl 2-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]acetate;dihydrochloride.
| Compound Name | ethyl 2-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]acetate;dihydrochloride |
|---|---|
| PubChem CID | 141002162 |
| Molecular Formula | C17H18Cl2N4O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | ethyl 2-[3H-benzimidazole-5-carbonyl(pyridin-2-yl)amino]acetate;dihydrochloride |
| SMILES | CCOC(=O)CN(C(=O)c1ccc2nc[nH]c2c1)c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C17H16N4O3.2ClH/c1-2-24-16(22)10-21(15-5-3-4-8-18-15)17(23)12-6-7-13-14(9-12)20-11-19-13;;/h3-9,11H,2,10H2,1H3,(H,19,20);2*1H |
| InChIKey | DMPUDMUGZXOFQY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |