C20H26N4O3 — CID 123864067
ethyl 3-[[1-hydroxy-1-[4-(methylamino)-3-(methylideneamino)phenyl]ethyl]-pyridin-2-ylamino]propanoate (PubChem CID 123864067) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl 3-[[1-hydroxy-1-[4-(methylamino)-3-(methylideneamino)phenyl]ethyl]-pyridin-2-ylamino]propanoate.
| Compound Name | ethyl 3-[[1-hydroxy-1-[4-(methylamino)-3-(methylideneamino)phenyl]ethyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 123864067 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | ethyl 3-[[1-hydroxy-1-[4-(methylamino)-3-(methylideneamino)phenyl]ethyl]-pyridin-2-ylamino]propanoate |
| SMILES | C=Nc1cc(C(C)(O)N(CCC(=O)OCC)c2ccccn2)ccc1NC |
| InChI | InChI=1S/C20H26N4O3/c1-5-27-19(25)11-13-24(18-8-6-7-12-23-18)20(2,26)15-9-10-16(21-3)17(14-15)22-4/h6-10,12,14,21,26H,4-5,11,13H2,1-3H3 |
| InChIKey | MVZLBBUXHHCCSQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|