C19H23N3O3 — CID 18412328
ethyl 3-(N-[3-amino-4-(methylamino)benzoyl]anilino)propanoate (PubChem CID 18412328) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 3-(N-[3-amino-4-(methylamino)benzoyl]anilino)propanoate.
| Compound Name | ethyl 3-(N-[3-amino-4-(methylamino)benzoyl]anilino)propanoate |
|---|---|
| PubChem CID | 18412328 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | ethyl 3-(N-[3-amino-4-(methylamino)benzoyl]anilino)propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc(NC)c(N)c1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-3-25-18(23)11-12-22(15-7-5-4-6-8-15)19(24)14-9-10-17(21-2)16(20)13-14/h4-10,13,21H,3,11-12,20H2,1-2H3 |
| InChIKey | USYDQCNSLKAPJN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|