C18H20N3O5- — CID 163963236
[5-[(3-methoxy-3-oxopropyl)-phenylcarbamoyl]-2-(methylamino)phenyl]-dioxidoazanium (PubChem CID 163963236) has the molecular formula C18H20N3O5- and a molecular weight of 358.37 g/mol. Its IUPAC name is [5-[(3-methoxy-3-oxopropyl)-phenylcarbamoyl]-2-(methylamino)phenyl]-dioxidoazanium.
| Compound Name | [5-[(3-methoxy-3-oxopropyl)-phenylcarbamoyl]-2-(methylamino)phenyl]-dioxidoazanium |
|---|---|
| PubChem CID | 163963236 |
| Molecular Formula | C18H20N3O5- |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [5-[(3-methoxy-3-oxopropyl)-phenylcarbamoyl]-2-(methylamino)phenyl]-dioxidoazanium |
| SMILES | CNc1ccc(C(=O)N(CCC(=O)OC)c2ccccc2)cc1[NH+]([O-])[O-] |
| InChI | InChI=1S/C18H20N3O5/c1-19-15-9-8-13(12-16(15)21(24)25)18(23)20(11-10-17(22)26-2)14-6-4-3-5-7-14/h3-9,12,19,21H,10-11H2,1-2H3/q-1 |
| InChIKey | SJIOGTWFPQYLIF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|