C27H24N4O3 — CID 18412419
methyl 3-(N-[2-[(4-cyanoanilino)methyl]-1H-indole-5-carbonyl]anilino)propanoate (PubChem CID 18412419) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is methyl 3-(N-[2-[(4-cyanoanilino)methyl]-1H-indole-5-carbonyl]anilino)propanoate.
| Compound Name | methyl 3-(N-[2-[(4-cyanoanilino)methyl]-1H-indole-5-carbonyl]anilino)propanoate |
|---|---|
| PubChem CID | 18412419 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | methyl 3-(N-[2-[(4-cyanoanilino)methyl]-1H-indole-5-carbonyl]anilino)propanoate |
| SMILES | COC(=O)CCN(C(=O)c1ccc2[nH]c(CNc3ccc(C#N)cc3)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C27H24N4O3/c1-34-26(32)13-14-31(24-5-3-2-4-6-24)27(33)20-9-12-25-21(15-20)16-23(30-25)18-29-22-10-7-19(17-28)8-11-22/h2-12,15-16,29-30H,13-14,18H2,1H3 |
| InChIKey | IBDOSCHKLYLJMA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |