C34H38N6O5 — CID 18412289
methyl 3-(N-[2-[[4-[(E)-N'-cyclohexyloxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]anilino)propanoate (PubChem CID 18412289) has the molecular formula C34H38N6O5 and a molecular weight of 610.72 g/mol. Its IUPAC name is methyl 3-(N-[2-[[4-[(E)-N'-cyclohexyloxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]anilino)propanoate.
| Compound Name | methyl 3-(N-[2-[[4-[(E)-N'-cyclohexyloxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]anilino)propanoate |
|---|---|
| PubChem CID | 18412289 |
| Molecular Formula | C34H38N6O5 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | methyl 3-(N-[2-[[4-[(E)-N'-cyclohexyloxycarbonylcarbamimidoyl]anilino]methyl]-1-methylbenzimidazole-5-carbonyl]anilino)propanoate |
| SMILES | COC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N\C(=O)OC3CCCCC3)cc1)n2C)c1ccccc1 |
| InChI | InChI=1S/C34H38N6O5/c1-39-29-18-15-24(33(42)40(20-19-31(41)44-2)26-9-5-3-6-10-26)21-28(29)37-30(39)22-36-25-16-13-23(14-17-25)32(35)38-34(43)45-27-11-7-4-8-12-27/h3,5-6,9-10,13-18,21,27,36H,4,7-8,11-12,19-20,22H2,1-2H3,(H2,35,38,43) |
| InChIKey | RKYSDJOXVUTFDE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|