C36H34F3N7O6 — CID 118883202
(2-methoxyphenyl) 3-[[1-methyl-2-[[4-[(Z)-N'-(3,3,3-trifluoropropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate (PubChem CID 118883202) has the molecular formula C36H34F3N7O6 and a molecular weight of 717.71 g/mol. Its IUPAC name is (2-methoxyphenyl) 3-[[1-methyl-2-[[4-[(Z)-N'-(3,3,3-trifluoropropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate.
| Compound Name | (2-methoxyphenyl) 3-[[1-methyl-2-[[4-[(Z)-N'-(3,3,3-trifluoropropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
|---|---|
| PubChem CID | 118883202 |
| Molecular Formula | C36H34F3N7O6 |
| Molecular Weight | 717.71 g/mol |
| Exact Mass | 717.25 |
| IUPAC Name | (2-methoxyphenyl) 3-[[1-methyl-2-[[4-[(Z)-N'-(3,3,3-trifluoropropoxycarbonyl)carbamimidoyl]anilino]methyl]benzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate |
| SMILES | COc1ccccc1OC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(/C(N)=N/C(=O)OCCC(F)(F)F)cc1)n2C)c1ccccn1 |
| InChI | InChI=1S/C36H34F3N7O6/c1-45-27-15-12-24(34(48)46(30-9-5-6-18-41-30)19-16-32(47)52-29-8-4-3-7-28(29)50-2)21-26(27)43-31(45)22-42-25-13-10-23(11-14-25)33(40)44-35(49)51-20-17-36(37,38)39/h3-15,18,21,42H,16-17,19-20,22H2,1-2H3,(H2,40,44,49) |
| InChIKey | IEUIFCHQZMSYCC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.71 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|