C28H30IN5O3 — CID 18412383
methyl 3-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylindole-5-carbonyl]anilino)propanoate;hydroiodide (PubChem CID 18412383) has the molecular formula C28H30IN5O3 and a molecular weight of 611.48 g/mol. Its IUPAC name is methyl 3-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylindole-5-carbonyl]anilino)propanoate;hydroiodide.
| Compound Name | methyl 3-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylindole-5-carbonyl]anilino)propanoate;hydroiodide |
|---|---|
| PubChem CID | 18412383 |
| Molecular Formula | C28H30IN5O3 |
| Molecular Weight | 611.48 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | methyl 3-(N-[2-[(4-carbamimidoylanilino)methyl]-1-methylindole-5-carbonyl]anilino)propanoate;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1ccc(NCc2cc3cc(C(=O)N(CCC(=O)OC)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C28H29N5O3.HI/c1-32-24(18-31-22-11-8-19(9-12-22)27(29)30)17-21-16-20(10-13-25(21)32)28(35)33(15-14-26(34)36-2)23-6-4-3-5-7-23;/h3-13,16-17,31H,14-15,18H2,1-2H3,(H3,29,30);1H |
| InChIKey | DLEKUDHEVFGCIB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|