C19H25N3O3 — CID 58545024
ethyl 7-[(4-oxo-1H-pyridin-2-yl)-pyridin-2-ylamino]heptanoate (PubChem CID 58545024) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 7-[(4-oxo-1H-pyridin-2-yl)-pyridin-2-ylamino]heptanoate.
| Compound Name | ethyl 7-[(4-oxo-1H-pyridin-2-yl)-pyridin-2-ylamino]heptanoate |
|---|---|
| PubChem CID | 58545024 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | ethyl 7-[(4-oxo-1H-pyridin-2-yl)-pyridin-2-ylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(c1ccccn1)c1cc(=O)cc[nH]1 |
| InChI | InChI=1S/C19H25N3O3/c1-2-25-19(24)10-5-3-4-8-14-22(17-9-6-7-12-20-17)18-15-16(23)11-13-21-18/h6-7,9,11-13,15H,2-5,8,10,14H2,1H3,(H,21,23) |
| InChIKey | JBLSZGHRVHQJOF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|