C17H24N4O2S — CID 90134033
ethyl 7-[(3-methyl-1,2,4-thiadiazol-5-yl)-pyridin-3-ylamino]heptanoate (PubChem CID 90134033) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is ethyl 7-[(3-methyl-1,2,4-thiadiazol-5-yl)-pyridin-3-ylamino]heptanoate.
| Compound Name | ethyl 7-[(3-methyl-1,2,4-thiadiazol-5-yl)-pyridin-3-ylamino]heptanoate |
|---|---|
| PubChem CID | 90134033 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | ethyl 7-[(3-methyl-1,2,4-thiadiazol-5-yl)-pyridin-3-ylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(c1cccnc1)c1nc(C)ns1 |
| InChI | InChI=1S/C17H24N4O2S/c1-3-23-16(22)10-6-4-5-7-12-21(15-9-8-11-18-13-15)17-19-14(2)20-24-17/h8-9,11,13H,3-7,10,12H2,1-2H3 |
| InChIKey | JAJPWEUAXCQZBG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|