C12H15N5S2 — CID 65268022
3-[(3-methyl-1,2,4-thiadiazol-5-yl)-(pyridin-3-ylmethyl)amino]propanethioamide (PubChem CID 65268022) has the molecular formula C12H15N5S2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 3-[(3-methyl-1,2,4-thiadiazol-5-yl)-(pyridin-3-ylmethyl)amino]propanethioamide.
| Compound Name | 3-[(3-methyl-1,2,4-thiadiazol-5-yl)-(pyridin-3-ylmethyl)amino]propanethioamide |
|---|---|
| PubChem CID | 65268022 |
| Molecular Formula | C12H15N5S2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-[(3-methyl-1,2,4-thiadiazol-5-yl)-(pyridin-3-ylmethyl)amino]propanethioamide |
| SMILES | Cc1nsc(N(CCC(N)=S)Cc2cccnc2)n1 |
| InChI | InChI=1S/C12H15N5S2/c1-9-15-12(19-16-9)17(6-4-11(13)18)8-10-3-2-5-14-7-10/h2-3,5,7H,4,6,8H2,1H3,(H2,13,18) |
| InChIKey | OXDBFOUGNHWSHF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|