C12H13N5OS2 — CID 65216045
N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiadiazole-4-carboxamide (PubChem CID 65216045) has the molecular formula C12H13N5OS2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiadiazole-4-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216045 |
| Molecular Formula | C12H13N5OS2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiadiazole-4-carboxamide |
| SMILES | NC(=S)CCN(Cc1cccnc1)C(=O)c1csnn1 |
| InChI | InChI=1S/C12H13N5OS2/c13-11(19)3-5-17(7-9-2-1-4-14-6-9)12(18)10-8-20-16-15-10/h1-2,4,6,8H,3,5,7H2,(H2,13,19) |
| InChIKey | WCARFUJIAZWQKQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|