C15H21N3OS2 — CID 80587184
N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiane-2-carboxamide (PubChem CID 80587184) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiane-2-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 80587184 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-(pyridin-3-ylmethyl)thiane-2-carboxamide |
| SMILES | NC(=S)CCN(Cc1cccnc1)C(=O)C1CCCCS1 |
| InChI | InChI=1S/C15H21N3OS2/c16-14(20)6-8-18(11-12-4-3-7-17-10-12)15(19)13-5-1-2-9-21-13/h3-4,7,10,13H,1-2,5-6,8-9,11H2,(H2,16,20) |
| InChIKey | QXPXCTXHIQPTTN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|