C12H13BrN4S2 — CID 79399337
3-[(4-bromo-1,3-thiazol-2-yl)-(pyridin-3-ylmethyl)amino]propanethioamide (PubChem CID 79399337) has the molecular formula C12H13BrN4S2 and a molecular weight of 357.30 g/mol. Its IUPAC name is 3-[(4-bromo-1,3-thiazol-2-yl)-(pyridin-3-ylmethyl)amino]propanethioamide.
| Compound Name | 3-[(4-bromo-1,3-thiazol-2-yl)-(pyridin-3-ylmethyl)amino]propanethioamide |
|---|---|
| PubChem CID | 79399337 |
| Molecular Formula | C12H13BrN4S2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 3-[(4-bromo-1,3-thiazol-2-yl)-(pyridin-3-ylmethyl)amino]propanethioamide |
| SMILES | NC(=S)CCN(Cc1cccnc1)c1nc(Br)cs1 |
| InChI | InChI=1S/C12H13BrN4S2/c13-10-8-19-12(16-10)17(5-3-11(14)18)7-9-2-1-4-15-6-9/h1-2,4,6,8H,3,5,7H2,(H2,14,18) |
| InChIKey | OPWIMNZQEBARBC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|