C14H14BrClN4S — CID 114835479
3-[(3-bromo-5-chloro-2-pyridinyl)-(pyridin-3-ylmethyl)amino]propanethioamide (PubChem CID 114835479) has the molecular formula C14H14BrClN4S and a molecular weight of 385.72 g/mol. Its IUPAC name is 3-[(3-bromo-5-chloro-2-pyridinyl)-(pyridin-3-ylmethyl)amino]propanethioamide.
| Compound Name | 3-[(3-bromo-5-chloro-2-pyridinyl)-(pyridin-3-ylmethyl)amino]propanethioamide |
|---|---|
| PubChem CID | 114835479 |
| Molecular Formula | C14H14BrClN4S |
| Molecular Weight | 385.72 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 3-[(3-bromo-5-chloro-2-pyridinyl)-(pyridin-3-ylmethyl)amino]propanethioamide |
| SMILES | NC(=S)CCN(Cc1cccnc1)c1ncc(Cl)cc1Br |
| InChI | InChI=1S/C14H14BrClN4S/c15-12-6-11(16)8-19-14(12)20(5-3-13(17)21)9-10-2-1-4-18-7-10/h1-2,4,6-8H,3,5,9H2,(H2,17,21) |
| InChIKey | JIWQDEBZHUKESL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|