C15H25N3O4S2 — CID 24666466
N-[2-(2-methylpropanoylamino)ethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide (PubChem CID 24666466) has the molecular formula C15H25N3O4S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[2-(2-methylpropanoylamino)ethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide.
| Compound Name | N-[2-(2-methylpropanoylamino)ethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
|---|---|
| PubChem CID | 24666466 |
| Molecular Formula | C15H25N3O4S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[2-(2-methylpropanoylamino)ethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)CCCN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H25N3O4S2/c1-12(2)15(20)17-9-8-16-13(19)6-4-10-18(3)24(21,22)14-7-5-11-23-14/h5,7,11-12H,4,6,8-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | FZCMYZAHQGFHQN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|