C16H17F3N2O3S3 — CID 167766558
4-[methyl(thiophen-2-ylsulfonyl)amino]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide (PubChem CID 167766558) has the molecular formula C16H17F3N2O3S3 and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide.
| Compound Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 167766558 |
| Molecular Formula | C16H17F3N2O3S3 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide |
| SMILES | CN(CCCC(=O)Nc1ccccc1SC(F)(F)F)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H17F3N2O3S3/c1-21(27(23,24)15-9-5-11-25-15)10-4-8-14(22)20-12-6-2-3-7-13(12)26-16(17,18)19/h2-3,5-7,9,11H,4,8,10H2,1H3,(H,20,22) |
| InChIKey | DTHIDZGGJFNBHC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |