C19H28N2O3S2 — CID 17440887
N-(1-adamantyl)-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide (PubChem CID 17440887) has the molecular formula C19H28N2O3S2 and a molecular weight of 396.58 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide.
| Compound Name | N-(1-adamantyl)-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
|---|---|
| PubChem CID | 17440887 |
| Molecular Formula | C19H28N2O3S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(1-adamantyl)-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
| SMILES | CN(CCCC(=O)NC12CC3CC(CC(C3)C1)C2)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H28N2O3S2/c1-21(26(23,24)18-5-3-7-25-18)6-2-4-17(22)20-19-11-14-8-15(12-19)10-16(9-14)13-19/h3,5,7,14-16H,2,4,6,8-13H2,1H3,(H,20,22) |
| InChIKey | HGVPSNITEMDRBA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |