C15H19N3O3S2 — CID 18136265
4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 18136265) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 18136265 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-[methyl(thiophen-2-ylsulfonyl)amino]-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | CN(CCCC(=O)NCc1ccncc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-18(23(20,21)15-5-3-11-22-15)10-2-4-14(19)17-12-13-6-8-16-9-7-13/h3,5-9,11H,2,4,10,12H2,1H3,(H,17,19) |
| InChIKey | LSAXKZRKPXYPOG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |