C16H24N4O3S2 — CID 134011784
N-[2-(2-methylpropyl)pyrazol-3-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide (PubChem CID 134011784) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-[2-(2-methylpropyl)pyrazol-3-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide.
| Compound Name | N-[2-(2-methylpropyl)pyrazol-3-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
|---|---|
| PubChem CID | 134011784 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[2-(2-methylpropyl)pyrazol-3-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
| SMILES | CC(C)Cn1nccc1NC(=O)CCCN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H24N4O3S2/c1-13(2)12-20-14(8-9-17-20)18-15(21)6-4-10-19(3)25(22,23)16-7-5-11-24-16/h5,7-9,11,13H,4,6,10,12H2,1-3H3,(H,18,21) |
| InChIKey | IFKRNIYGNNOAND-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |