C23H26N2O3S2 — CID 24596245
N-[(4-methylphenyl)-phenylmethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide (PubChem CID 24596245) has the molecular formula C23H26N2O3S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is N-[(4-methylphenyl)-phenylmethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide.
| Compound Name | N-[(4-methylphenyl)-phenylmethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
|---|---|
| PubChem CID | 24596245 |
| Molecular Formula | C23H26N2O3S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[(4-methylphenyl)-phenylmethyl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
| SMILES | Cc1ccc(C(NC(=O)CCCN(C)S(=O)(=O)c2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O3S2/c1-18-12-14-20(15-13-18)23(19-8-4-3-5-9-19)24-21(26)10-6-16-25(2)30(27,28)22-11-7-17-29-22/h3-5,7-9,11-15,17,23H,6,10,16H2,1-2H3,(H,24,26) |
| InChIKey | AOIIFSJIWXNZRO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |