C20H22N2O4S2 — CID 23743563
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-prop-2-enylthiophene-2-sulfonamide (PubChem CID 23743563) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-prop-2-enylthiophene-2-sulfonamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-prop-2-enylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23743563 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-prop-2-enylthiophene-2-sulfonamide |
| SMILES | C=CCN(C1CC(=O)N(c2ccc(C(C)C)cc2)C1=O)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H22N2O4S2/c1-4-11-21(28(25,26)19-6-5-12-27-19)17-13-18(23)22(20(17)24)16-9-7-15(8-10-16)14(2)3/h4-10,12,14,17H,1,11,13H2,2-3H3 |
| InChIKey | MAWRBKWDOSRQFC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|