C23H23N3O4S2 — CID 23914929
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 23914929) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23914929 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(N2C(=O)CC(N(CCC3=CCCCC3)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C23H23N3O4S2/c24-16-18-8-10-19(11-9-18)26-21(27)15-20(23(26)28)25(13-12-17-5-2-1-3-6-17)32(29,30)22-7-4-14-31-22/h4-5,7-11,14,20H,1-3,6,12-13,15H2 |
| InChIKey | YKFGNPKAVGPSGP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|