C19H18N2O6S2 — CID 23772653
methyl 4-[2,5-dioxo-3-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]pyrrolidin-1-yl]benzoate (PubChem CID 23772653) has the molecular formula C19H18N2O6S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is methyl 4-[2,5-dioxo-3-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]pyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dioxo-3-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23772653 |
| Molecular Formula | C19H18N2O6S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | methyl 4-[2,5-dioxo-3-[prop-2-enyl(thiophen-2-ylsulfonyl)amino]pyrrolidin-1-yl]benzoate |
| SMILES | C=CCN(C1CC(=O)N(c2ccc(C(=O)OC)cc2)C1=O)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H18N2O6S2/c1-3-10-20(29(25,26)17-5-4-11-28-17)15-12-16(22)21(18(15)23)14-8-6-13(7-9-14)19(24)27-2/h3-9,11,15H,1,10,12H2,2H3 |
| InChIKey | GVJHLXQNUFTEPK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|