C23H17N3O6S2 — CID 23772775
N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 23772775) has the molecular formula C23H17N3O6S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23772775 |
| Molecular Formula | C23H17N3O6S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O6S2/c24-12-15-3-6-17(7-4-15)26-21(27)11-18(23(26)28)25(34(29,30)22-2-1-9-33-22)13-16-5-8-19-20(10-16)32-14-31-19/h1-10,18H,11,13-14H2 |
| InChIKey | MKZNGPPXHJOWKB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|