C20H16BrN3O4S2 — CID 23886714
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide (PubChem CID 23886714) has the molecular formula C20H16BrN3O4S2 and a molecular weight of 506.40 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23886714 |
| Molecular Formula | C20H16BrN3O4S2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 504.98 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=C1CC(N(Cc2cccnc2)S(=O)(=O)c2cccs2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrN3O4S2/c21-15-5-7-16(8-6-15)24-18(25)11-17(20(24)26)23(13-14-3-1-9-22-12-14)30(27,28)19-4-2-10-29-19/h1-10,12,17H,11,13H2 |
| InChIKey | KVBZDUGKWVBZSN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|