C21H16Br2N2O4S2 — CID 23886708
4-bromo-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 23886708) has the molecular formula C21H16Br2N2O4S2 and a molecular weight of 584.31 g/mol. Its IUPAC name is 4-bromo-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23886708 |
| Molecular Formula | C21H16Br2N2O4S2 |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 581.89 |
| IUPAC Name | 4-bromo-N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C1CC(N(Cc2cccs2)S(=O)(=O)c2ccc(Br)cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16Br2N2O4S2/c22-14-3-7-16(8-4-14)25-20(26)12-19(21(25)27)24(13-17-2-1-11-30-17)31(28,29)18-9-5-15(23)6-10-18/h1-11,19H,12-13H2 |
| InChIKey | GTUAFZXNQNSMKF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|