C22H16BrN3O5S — CID 23774484
N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 23774484) has the molecular formula C22H16BrN3O5S and a molecular weight of 514.36 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23774484 |
| Molecular Formula | C22H16BrN3O5S |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C1CC(N(Cc2cccs2)C(=O)c2cccc([N+](=O)[O-])c2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16BrN3O5S/c23-15-6-8-16(9-7-15)25-20(27)12-19(22(25)29)24(13-18-5-2-10-32-18)21(28)14-3-1-4-17(11-14)26(30)31/h1-11,19H,12-13H2 |
| InChIKey | SQKBRLCJEOWYNE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|