C25H18BrN3O6S — CID 23970801
N-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 23970801) has the molecular formula C25H18BrN3O6S and a molecular weight of 568.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23970801 |
| Molecular Formula | C25H18BrN3O6S |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 567.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)S(=O)(=O)c3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H18BrN3O6S/c26-18-4-8-20(9-5-18)36(32,33)28(14-17-3-10-22-23(11-17)35-15-34-22)21-12-24(30)29(25(21)31)19-6-1-16(13-27)2-7-19/h1-11,21H,12,14-15H2 |
| InChIKey | UDRCZEWFMHZCQW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|