C28H21N3O4S — CID 23743625
N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-sulfonamide (PubChem CID 23743625) has the molecular formula C28H21N3O4S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-sulfonamide.
| Compound Name | N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 23743625 |
| Molecular Formula | C28H21N3O4S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-benzyl-N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]naphthalene-2-sulfonamide |
| SMILES | N#Cc1ccc(N2C(=O)CC(N(Cc3ccccc3)S(=O)(=O)c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C28H21N3O4S/c29-18-20-10-13-24(14-11-20)31-27(32)17-26(28(31)33)30(19-21-6-2-1-3-7-21)36(34,35)25-15-12-22-8-4-5-9-23(22)16-25/h1-16,26H,17,19H2 |
| InChIKey | JBKXNPLQWLABFY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|