C26H21FN2O8S — CID 23886767
methyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23886767) has the molecular formula C26H21FN2O8S and a molecular weight of 540.53 g/mol. Its IUPAC name is methyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23886767 |
| Molecular Formula | C26H21FN2O8S |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | methyl 4-[3-[1,3-benzodioxol-5-ylmethyl-(4-fluorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(Cc3ccc4c(c3)OCO4)S(=O)(=O)c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H21FN2O8S/c1-35-26(32)17-3-7-19(8-4-17)29-24(30)13-21(25(29)31)28(38(33,34)20-9-5-18(27)6-10-20)14-16-2-11-22-23(12-16)37-15-36-22/h2-12,21H,13-15H2,1H3 |
| InChIKey | CPBMEDMDPWYXTE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|