C22H16Cl2FN3O4S — CID 23743708
2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 23743708) has the molecular formula C22H16Cl2FN3O4S and a molecular weight of 508.36 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23743708 |
| Molecular Formula | C22H16Cl2FN3O4S |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | 2,5-dichloro-N-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | O=C1CC(N(Cc2cccnc2)S(=O)(=O)c2cc(Cl)ccc2Cl)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16Cl2FN3O4S/c23-15-3-8-18(24)20(10-15)33(31,32)27(13-14-2-1-9-26-12-14)19-11-21(29)28(22(19)30)17-6-4-16(25)5-7-17/h1-10,12,19H,11,13H2 |
| InChIKey | PYDZYTOLBYBGPE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|