C22H22Cl2N2O5S — CID 23970834
2,5-dichloro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 23970834) has the molecular formula C22H22Cl2N2O5S and a molecular weight of 497.40 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23970834 |
| Molecular Formula | C22H22Cl2N2O5S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2,5-dichloro-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(CC3CCCO3)S(=O)(=O)c3cc(Cl)ccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O5S/c1-14-4-7-16(8-5-14)26-21(27)12-19(22(26)28)25(13-17-3-2-10-31-17)32(29,30)20-11-15(23)6-9-18(20)24/h4-9,11,17,19H,2-3,10,12-13H2,1H3 |
| InChIKey | CCQQSZBXADJMKN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|