C23H26N2O5S — CID 23743652
4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 23743652) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23743652 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-methyl-N-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(N2C(=O)CC(N(CC3CCCO3)S(=O)(=O)c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O5S/c1-16-5-9-18(10-6-16)25-22(26)14-21(23(25)27)24(15-19-4-3-13-30-19)31(28,29)20-11-7-17(2)8-12-20/h5-12,19,21H,3-4,13-15H2,1-2H3 |
| InChIKey | LWAXTIXFIALYGS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|