C26H21Cl3N2O6S — CID 23886797
[4-[3-[2-(3-chlorophenyl)ethyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23886797) has the molecular formula C26H21Cl3N2O6S and a molecular weight of 595.89 g/mol. Its IUPAC name is [4-[3-[2-(3-chlorophenyl)ethyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[2-(3-chlorophenyl)ethyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23886797 |
| Molecular Formula | C26H21Cl3N2O6S |
| Molecular Weight | 595.89 g/mol |
| Exact Mass | 594.02 |
| IUPAC Name | [4-[3-[2-(3-chlorophenyl)ethyl-(2,5-dichlorophenyl)sulfonylamino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)CC(N(CCc3cccc(Cl)c3)S(=O)(=O)c3cc(Cl)ccc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C26H21Cl3N2O6S/c1-16(32)37-21-8-6-20(7-9-21)31-25(33)15-23(26(31)34)30(12-11-17-3-2-4-18(27)13-17)38(35,36)24-14-19(28)5-10-22(24)29/h2-10,13-14,23H,11-12,15H2,1H3 |
| InChIKey | ZLJSNYWMXLJYDP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|