C26H23ClN2O6S — CID 23886802
[4-[3-[(4-chlorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate (PubChem CID 23886802) has the molecular formula C26H23ClN2O6S and a molecular weight of 527.00 g/mol. Its IUPAC name is [4-[3-[(4-chlorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate.
| Compound Name | [4-[3-[(4-chlorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 23886802 |
| Molecular Formula | C26H23ClN2O6S |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | [4-[3-[(4-chlorophenyl)sulfonyl-[(4-methylphenyl)methyl]amino]-2,5-dioxopyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)CC(N(Cc3ccc(C)cc3)S(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H23ClN2O6S/c1-17-3-5-19(6-4-17)16-28(36(33,34)23-13-7-20(27)8-14-23)24-15-25(31)29(26(24)32)21-9-11-22(12-10-21)35-18(2)30/h3-14,24H,15-16H2,1-2H3 |
| InChIKey | UYTBXINHAACIIU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|