C27H25ClN2O4 — CID 23998853
N-[2-(3-chlorophenyl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenylacetamide (PubChem CID 23998853) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenylacetamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23998853 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N-[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2-phenylacetamide |
| SMILES | COc1ccc(N2C(=O)CC(N(CCc3cccc(Cl)c3)C(=O)Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H25ClN2O4/c1-34-23-12-10-22(11-13-23)30-26(32)18-24(27(30)33)29(15-14-20-8-5-9-21(28)16-20)25(31)17-19-6-3-2-4-7-19/h2-13,16,24H,14-15,17-18H2,1H3 |
| InChIKey | AEJDCYVQOGBIIS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|