C22H20ClFN2O4 — CID 23745254
N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-fluoro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 23745254) has the molecular formula C22H20ClFN2O4 and a molecular weight of 430.86 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-fluoro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-fluoro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23745254 |
| Molecular Formula | C22H20ClFN2O4 |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-2-fluoro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C1CC(N(CC2CCCO2)C(=O)c2ccccc2F)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClFN2O4/c23-14-7-9-15(10-8-14)26-20(27)12-19(22(26)29)25(13-16-4-3-11-30-16)21(28)17-5-1-2-6-18(17)24/h1-2,5-10,16,19H,3-4,11-13H2 |
| InChIKey | YNLQUIWZDNUTBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|