C19H18Cl2N2O6 — CID 40922378
(E)-4-[[(3S)-1-(2,6-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[[(2S)-oxolan-2-yl]methyl]amino]-4-oxobut-2-enoic acid (PubChem CID 40922378) has the molecular formula C19H18Cl2N2O6 and a molecular weight of 441.27 g/mol. Its IUPAC name is (E)-4-[[(3S)-1-(2,6-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[[(2S)-oxolan-2-yl]methyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[(3S)-1-(2,6-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[[(2S)-oxolan-2-yl]methyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 40922378 |
| Molecular Formula | C19H18Cl2N2O6 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (E)-4-[[(3S)-1-(2,6-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-[[(2S)-oxolan-2-yl]methyl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N(C[C@@H]1CCCO1)[C@H]1CC(=O)N(c2c(Cl)cccc2Cl)C1=O |
| InChI | InChI=1S/C19H18Cl2N2O6/c20-12-4-1-5-13(21)18(12)23-16(25)9-14(19(23)28)22(10-11-3-2-8-29-11)15(24)6-7-17(26)27/h1,4-7,11,14H,2-3,8-10H2,(H,26,27)/b7-6+/t11-,14-/m0/s1 |
| InChIKey | CSEXFXUVFPQNRI-MEQIJJHFSA-N |
| XLogP | 2.27 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|