C25H26ClN3O5 — CID 23802087
N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 23802087) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 23802087 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[1-(4-acetamidophenyl)-2,5-dioxopyrrolidin-3-yl]-2-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)CC(N(CC3CCCO3)C(=O)Cc3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H26ClN3O5/c1-16(30)27-19-8-10-20(11-9-19)29-24(32)14-22(25(29)33)28(15-21-3-2-12-34-21)23(31)13-17-4-6-18(26)7-5-17/h4-11,21-22H,2-3,12-15H2,1H3,(H,27,30) |
| InChIKey | UGASUMVVIGPVON-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|