C26H26Cl2N2O3 — CID 23802075
2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 23802075) has the molecular formula C26H26Cl2N2O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 23802075 |
| Molecular Formula | C26H26Cl2N2O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | O=C1CC(N(CCC2=CCCCC2)C(=O)Cc2ccc(Cl)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26Cl2N2O3/c27-20-8-6-19(7-9-20)16-24(31)29(15-14-18-4-2-1-3-5-18)23-17-25(32)30(26(23)33)22-12-10-21(28)11-13-22/h4,6-13,23H,1-3,5,14-17H2 |
| InChIKey | MLNBGXRSEGECKP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|