C20H17FN2O3 — CID 23745245
N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluoro-N-prop-2-enylbenzamide (PubChem CID 23745245) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluoro-N-prop-2-enylbenzamide.
| Compound Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluoro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 23745245 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-fluoro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccccc1F)C1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H17FN2O3/c1-2-12-22(19(25)15-10-6-7-11-16(15)21)17-13-18(24)23(20(17)26)14-8-4-3-5-9-14/h2-11,17H,1,12-13H2 |
| InChIKey | DGMSWOOSQGRXEA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|