C21H18ClN3O6S3 — CID 25044940
N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 25044940) has the molecular formula C21H18ClN3O6S3 and a molecular weight of 540.04 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25044940 |
| Molecular Formula | C21H18ClN3O6S3 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccccc3Cl)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C21H18ClN3O6S3/c22-17-5-2-1-4-14(17)13-24(34(30,31)20-6-3-11-32-20)18-12-19(26)25(21(18)27)15-7-9-16(10-8-15)33(23,28)29/h1-11,18H,12-13H2,(H2,23,28,29) |
| InChIKey | IAULRVMWDSYEIQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|