C22H18ClN3O5S2 — CID 25039680
N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 25039680) has the molecular formula C22H18ClN3O5S2 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25039680 |
| Molecular Formula | C22H18ClN3O5S2 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccccc3Cl)C(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C22H18ClN3O5S2/c23-17-5-2-1-4-14(17)13-25(22(29)19-6-3-11-32-19)18-12-20(27)26(21(18)28)15-7-9-16(10-8-15)33(24,30)31/h1-11,18H,12-13H2,(H2,24,30,31) |
| InChIKey | HZCPCUCMGAUSFW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|