C26H28N4O6S3 — CID 25036325
N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 25036325) has the molecular formula C26H28N4O6S3 and a molecular weight of 588.73 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25036325 |
| Molecular Formula | C26H28N4O6S3 |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C3CCN(Cc4ccccc4)CC3)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C26H28N4O6S3/c27-38(33,34)22-10-8-20(9-11-22)29-24(31)17-23(26(29)32)30(39(35,36)25-7-4-16-37-25)21-12-14-28(15-13-21)18-19-5-2-1-3-6-19/h1-11,16,21,23H,12-15,17-18H2,(H2,27,33,34) |
| InChIKey | MAOAVXLGRIISRK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|